C8H8F3NO — CID 145375190
(3E,5Z)-8,8,8-trifluoro-7-iminoocta-3,5-dien-2-one (PubChem CID 145375190) has the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. Its IUPAC name is (3E,5Z)-8,8,8-trifluoro-7-iminoocta-3,5-dien-2-one.
| Compound Name | (3E,5Z)-8,8,8-trifluoro-7-iminoocta-3,5-dien-2-one |
|---|---|
| PubChem CID | 145375190 |
| Molecular Formula | C8H8F3NO |
| Molecular Weight | 191.15 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | (3E,5Z)-8,8,8-trifluoro-7-iminoocta-3,5-dien-2-one |
| SMILES | [H]/N=C(\C=C/C=C/C(C)=O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO/c1-6(13)4-2-3-5-7(12)8(9,10)11/h2-5,12H,1H3/b4-2+,5-3-,12-7+ |
| InChIKey | QADOXAGSUFEZFA-ZVOSTLHGSA-N |
| XLogP | 2.27 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.15 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|