C10H13NO — CID 90855946
1-(5-imino-3-methylcyclohepta-1,6-dien-1-yl)ethanone (PubChem CID 90855946) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-(5-imino-3-methylcyclohepta-1,6-dien-1-yl)ethanone.
| Compound Name | 1-(5-imino-3-methylcyclohepta-1,6-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 90855946 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-(5-imino-3-methylcyclohepta-1,6-dien-1-yl)ethanone |
| SMILES | [H]/N=C1\C=CC(C(C)=O)=CC(C)C1 |
| InChI | InChI=1S/C10H13NO/c1-7-5-9(8(2)12)3-4-10(11)6-7/h3-5,7,11H,6H2,1-2H3/b11-10+ |
| InChIKey | MULUTFUMEZATCF-ZHACJKMWSA-N |
| XLogP | 2.12 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|