C13H21NO — CID 91262997
(Z,5E)-5-ethylidene-6-imino-3-methyldec-7-en-4-one (PubChem CID 91262997) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (Z,5E)-5-ethylidene-6-imino-3-methyldec-7-en-4-one.
| Compound Name | (Z,5E)-5-ethylidene-6-imino-3-methyldec-7-en-4-one |
|---|---|
| PubChem CID | 91262997 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (Z,5E)-5-ethylidene-6-imino-3-methyldec-7-en-4-one |
| SMILES | [H]/N=C(\C=C/CC)C(=C\C)/C(=O)C(C)CC |
| InChI | InChI=1S/C13H21NO/c1-5-8-9-12(14)11(7-3)13(15)10(4)6-2/h7-10,14H,5-6H2,1-4H3/b9-8-,11-7+,14-12+ |
| InChIKey | JYUWSGOOGJTGOF-WTMWUYOCSA-N |
| XLogP | 3.53 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|