C8H10N2O — CID 57207871
4,6-diimino-3,5-dimethylcyclohex-2-en-1-one (PubChem CID 57207871) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 4,6-diimino-3,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 4,6-diimino-3,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 57207871 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 4,6-diimino-3,5-dimethylcyclohex-2-en-1-one |
| SMILES | [H]/N=C1\C(=O)C=C(C)/C(=N\[H])C1C |
| InChI | InChI=1S/C8H10N2O/c1-4-3-6(11)8(10)5(2)7(4)9/h3,5,9-10H,1-2H3/b9-7+,10-8- |
| InChIKey | ZJFDRGIMLKAPJN-ZWOQCJTASA-N |
| XLogP | 1.19 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|