C7H8N2O — CID 56990817
4,5-diimino-3-methylcyclohex-2-en-1-one (PubChem CID 56990817) has the molecular formula C7H8N2O and a molecular weight of 136.15 g/mol. Its IUPAC name is 4,5-diimino-3-methylcyclohex-2-en-1-one.
| Compound Name | 4,5-diimino-3-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 56990817 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 4,5-diimino-3-methylcyclohex-2-en-1-one |
| SMILES | [H]/N=C1\CC(=O)C=C(C)\C1=N/[H] |
| InChI | InChI=1S/C7H8N2O/c1-4-2-5(10)3-6(8)7(4)9/h2,8-9H,3H2,1H3/b8-6+,9-7+ |
| InChIKey | XEORFCNHEODDKQ-CDJQDVQCSA-N |
| XLogP | 0.95 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|