About 5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one
5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one (PubChem CID 54255276) has the molecular formula C7H5NO
and a molecular weight of 119.12 g/mol. Its IUPAC name is 5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one.
Molecular Properties
| Compound Name | 5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one |
| PubChem CID | 54255276 |
| Molecular Formula | C7H5NO |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | 5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one |
| SMILES | [H]/N=C1\C=CC(=O)C2=C1C2 |
| InChI | InChI=1S/C7H5NO/c8-6-1-2-7(9)5-3-4(5)6/h1-2,8H,3H2/b8-6+ |
| InChIKey | QZPAQWKIRLMPCT-SOFGYWHQSA-N |
| XLogP | 0.85 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one?
The IUPAC name of 5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one (CID 54255276) is 5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one.
What is the SMILES notation for 5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one?
The canonical SMILES for 5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one is [H]/N=C1\C=CC(=O)C2=C1C2.
What is the InChIKey of 5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one?
The InChIKey is QZPAQWKIRLMPCT-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H5NO/c8-6-1-2-7(9)5-3-4(5)6/h1-2,8H,3H2/b8-6+.
What are the key properties of 5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one?
5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one has a molecular weight of 119.12 g/mol, XLogP of 0.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iminobicyclo[4.1.0]hepta-1(6),3-dien-2-one is sourced from PubChem (CID 54255276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).