About 5-imino-2-methylcyclohex-2-ene-1,4-dione
5-imino-2-methylcyclohex-2-ene-1,4-dione (PubChem CID 56613538) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is 5-imino-2-methylcyclohex-2-ene-1,4-dione.
Molecular Properties
| Compound Name | 5-imino-2-methylcyclohex-2-ene-1,4-dione |
| PubChem CID | 56613538 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 5-imino-2-methylcyclohex-2-ene-1,4-dione |
| SMILES | [H]/N=C1\CC(=O)C(C)=CC1=O |
| InChI | InChI=1S/C7H7NO2/c1-4-2-7(10)5(8)3-6(4)9/h2,8H,3H2,1H3/b8-5+ |
| InChIKey | DFWWHPIGDBBKMT-VMPITWQZSA-N |
| XLogP | 0.49 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-imino-2-methylcyclohex-2-ene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-imino-2-methylcyclohex-2-ene-1,4-dione?
The IUPAC name of 5-imino-2-methylcyclohex-2-ene-1,4-dione (CID 56613538) is 5-imino-2-methylcyclohex-2-ene-1,4-dione.
What is the SMILES notation for 5-imino-2-methylcyclohex-2-ene-1,4-dione?
The canonical SMILES for 5-imino-2-methylcyclohex-2-ene-1,4-dione is [H]/N=C1\CC(=O)C(C)=CC1=O.
What is the InChIKey of 5-imino-2-methylcyclohex-2-ene-1,4-dione?
The InChIKey is DFWWHPIGDBBKMT-VMPITWQZSA-N. The full InChI is InChI=1S/C7H7NO2/c1-4-2-7(10)5(8)3-6(4)9/h2,8H,3H2,1H3/b8-5+.
What are the key properties of 5-imino-2-methylcyclohex-2-ene-1,4-dione?
5-imino-2-methylcyclohex-2-ene-1,4-dione has a molecular weight of 137.14 g/mol, XLogP of 0.49, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-imino-2-methylcyclohex-2-ene-1,4-dione is sourced from PubChem (CID 56613538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).