C8H9NO2 — CID 57277998
5-imino-2,3-dimethylcyclohex-2-ene-1,4-dione (PubChem CID 57277998) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 5-imino-2,3-dimethylcyclohex-2-ene-1,4-dione.
| Compound Name | 5-imino-2,3-dimethylcyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 57277998 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 5-imino-2,3-dimethylcyclohex-2-ene-1,4-dione |
| SMILES | [H]/N=C1\CC(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C8H9NO2/c1-4-5(2)8(11)6(9)3-7(4)10/h9H,3H2,1-2H3/b9-6+ |
| InChIKey | KDSOCIHTAKUDOM-RMKNXTFCSA-N |
| XLogP | 0.88 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|