C15H21NO2 — CID 123910002
5-(6-imino-2-methylhept-2-enyl)cyclohept-5-ene-1,4-dione (PubChem CID 123910002) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 5-(6-imino-2-methylhept-2-enyl)cyclohept-5-ene-1,4-dione.
| Compound Name | 5-(6-imino-2-methylhept-2-enyl)cyclohept-5-ene-1,4-dione |
|---|---|
| PubChem CID | 123910002 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 5-(6-imino-2-methylhept-2-enyl)cyclohept-5-ene-1,4-dione |
| SMILES | [H]/N=C(\C)CCC=C(C)CC1=CCC(=O)CCC1=O |
| InChI | InChI=1S/C15H21NO2/c1-11(4-3-5-12(2)16)10-13-6-7-14(17)8-9-15(13)18/h4,6,16H,3,5,7-10H2,1-2H3/b11-4?,16-12+ |
| InChIKey | TXSHYPGXBSLMJG-WOCJIAOWSA-N |
| XLogP | 3.39 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|