C9H11NO2 — CID 166174992
2-ethyl-5-imino-6-methylcyclohex-2-ene-1,4-dione (PubChem CID 166174992) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-ethyl-5-imino-6-methylcyclohex-2-ene-1,4-dione.
| Compound Name | 2-ethyl-5-imino-6-methylcyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 166174992 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2-ethyl-5-imino-6-methylcyclohex-2-ene-1,4-dione |
| SMILES | [H]/N=C1\C(=O)C=C(CC)C(=O)C1C |
| InChI | InChI=1S/C9H11NO2/c1-3-6-4-7(11)8(10)5(2)9(6)12/h4-5,10H,3H2,1-2H3/b10-8- |
| InChIKey | UKJVWEARDGLESY-NTMALXAHSA-N |
| XLogP | 1.13 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|