C22H29NO — CID 139563439
(Z,5E)-5-ethylidene-1-imino-1-(2,3,4,9-tetrahydro-1H-benzo[7]annulen-7-yl)non-6-en-4-one (PubChem CID 139563439) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is (Z,5E)-5-ethylidene-1-imino-1-(2,3,4,9-tetrahydro-1H-benzo[7]annulen-7-yl)non-6-en-4-one.
| Compound Name | (Z,5E)-5-ethylidene-1-imino-1-(2,3,4,9-tetrahydro-1H-benzo[7]annulen-7-yl)non-6-en-4-one |
|---|---|
| PubChem CID | 139563439 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | (Z,5E)-5-ethylidene-1-imino-1-(2,3,4,9-tetrahydro-1H-benzo[7]annulen-7-yl)non-6-en-4-one |
| SMILES | [H]/N=C(\CCC(=O)C(/C=C\CC)=C/C)C1=CCC2=C(C=C1)CCCC2 |
| InChI | InChI=1S/C22H29NO/c1-3-5-8-17(4-2)22(24)16-15-21(23)20-13-11-18-9-6-7-10-19(18)12-14-20/h4-5,8,11,13-14,23H,3,6-7,9-10,12,15-16H2,1-2H3/b8-5-,17-4+,23-21+ |
| InChIKey | ZQYQQSWOFFGQAA-WAVBGCHMSA-N |
| XLogP | 6.02 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|