C15H21NO — CID 123834234
2-imino-1-(6-propan-2-ylcyclohepta-1,4,6-trien-1-yl)pentan-1-one (PubChem CID 123834234) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-imino-1-(6-propan-2-ylcyclohepta-1,4,6-trien-1-yl)pentan-1-one.
| Compound Name | 2-imino-1-(6-propan-2-ylcyclohepta-1,4,6-trien-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 123834234 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-imino-1-(6-propan-2-ylcyclohepta-1,4,6-trien-1-yl)pentan-1-one |
| SMILES | [H]/N=C(\CCC)C(=O)C1=CCC=CC(C(C)C)=C1 |
| InChI | InChI=1S/C15H21NO/c1-4-7-14(16)15(17)13-9-6-5-8-12(10-13)11(2)3/h5,8-11,16H,4,6-7H2,1-3H3/b16-14+ |
| InChIKey | RQEBFMOZSDWDEE-JQIJEIRASA-N |
| XLogP | 3.84 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|