C13H17NO — CID 123368774
(7E)-9-imino-7-methyl-4,6-dimethylidenedeca-2,7-dien-5-one (PubChem CID 123368774) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is (7E)-9-imino-7-methyl-4,6-dimethylidenedeca-2,7-dien-5-one.
| Compound Name | (7E)-9-imino-7-methyl-4,6-dimethylidenedeca-2,7-dien-5-one |
|---|---|
| PubChem CID | 123368774 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (7E)-9-imino-7-methyl-4,6-dimethylidenedeca-2,7-dien-5-one |
| SMILES | [H]/N=C(C)/C=C(\C)C(=C)C(=O)C(=C)C=CC |
| InChI | InChI=1S/C13H17NO/c1-6-7-9(2)13(15)12(5)10(3)8-11(4)14/h6-8,14H,2,5H2,1,3-4H3/b7-6?,10-8+,14-11+ |
| InChIKey | BXKMQJFCXSNQGL-LZKAPRTRSA-N |
| XLogP | 3.23 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|