C10H15NO — CID 123220309
(5Z)-5-ethanimidoyl-2-methylhepta-2,5-dien-4-one (PubChem CID 123220309) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (5Z)-5-ethanimidoyl-2-methylhepta-2,5-dien-4-one.
| Compound Name | (5Z)-5-ethanimidoyl-2-methylhepta-2,5-dien-4-one |
|---|---|
| PubChem CID | 123220309 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (5Z)-5-ethanimidoyl-2-methylhepta-2,5-dien-4-one |
| SMILES | [H]/N=C(C)/C(=C/C)C(=O)C=C(C)C |
| InChI | InChI=1S/C10H15NO/c1-5-9(8(4)11)10(12)6-7(2)3/h5-6,11H,1-4H3/b9-5-,11-8+ |
| InChIKey | SFPATSJSNWIRNK-WZGGBKBVSA-N |
| XLogP | 2.51 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|