C12H19NO — CID 123675201
(5E,7E)-9-imino-6,7-dimethyldeca-5,7-dien-4-one (PubChem CID 123675201) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (5E,7E)-9-imino-6,7-dimethyldeca-5,7-dien-4-one.
| Compound Name | (5E,7E)-9-imino-6,7-dimethyldeca-5,7-dien-4-one |
|---|---|
| PubChem CID | 123675201 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (5E,7E)-9-imino-6,7-dimethyldeca-5,7-dien-4-one |
| SMILES | [H]/N=C(C)/C=C(C)/C(C)=C/C(=O)CCC |
| InChI | InChI=1S/C12H19NO/c1-5-6-12(14)8-10(3)9(2)7-11(4)13/h7-8,13H,5-6H2,1-4H3/b9-7+,10-8+,13-11+ |
| InChIKey | QVOLLCJMDMXAFA-CWCVLZLJSA-N |
| XLogP | 3.29 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|