C8H8NOY- — CID 59189396
4-imino-2,6-dimethylcyclohexa-2,5-dien-1-one;yttrium (PubChem CID 59189396) has the molecular formula C8H8NOY- and a molecular weight of 223.06 g/mol. Its IUPAC name is 4-imino-2,6-dimethylcyclohexa-2,5-dien-1-one;yttrium.
| Compound Name | 4-imino-2,6-dimethylcyclohexa-2,5-dien-1-one;yttrium |
|---|---|
| PubChem CID | 59189396 |
| Molecular Formula | C8H8NOY- |
| Molecular Weight | 223.06 g/mol |
| Exact Mass | 222.97 |
| IUPAC Name | 4-imino-2,6-dimethylcyclohexa-2,5-dien-1-one;yttrium |
| SMILES | [H]/N=C1/[C-]=C(C)C(=O)C(C)=C1.[Y] |
| InChI | InChI=1S/C8H8NO.Y/c1-5-3-7(9)4-6(2)8(5)10;/h3,9H,1-2H3;/q-1;/b9-7+; |
| InChIKey | FTKGUZFNUKTTNX-BXTVWIJMSA-N |
| XLogP | 1.28 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.06 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|