C10H17NO — CID 123527531
(E)-5-imino-3,6-dimethyloct-3-en-2-one (PubChem CID 123527531) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (E)-5-imino-3,6-dimethyloct-3-en-2-one.
| Compound Name | (E)-5-imino-3,6-dimethyloct-3-en-2-one |
|---|---|
| PubChem CID | 123527531 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (E)-5-imino-3,6-dimethyloct-3-en-2-one |
| SMILES | [H]/N=C(/C=C(\C)C(C)=O)C(C)CC |
| InChI | InChI=1S/C10H17NO/c1-5-7(2)10(11)6-8(3)9(4)12/h6-7,11H,5H2,1-4H3/b8-6+,11-10- |
| InChIKey | LRSVIQHEZJCPBJ-PRNVZQMKSA-N |
| XLogP | 2.59 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|