C9H11NO — CID 91220623
(5Z)-3-iminonona-5,7,8-trien-4-one (PubChem CID 91220623) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is (5Z)-3-iminonona-5,7,8-trien-4-one.
| Compound Name | (5Z)-3-iminonona-5,7,8-trien-4-one |
|---|---|
| PubChem CID | 91220623 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | (5Z)-3-iminonona-5,7,8-trien-4-one |
| SMILES | [H]/N=C(\CC)C(=O)/C=C\C=C=C |
| InChI | InChI=1S/C9H11NO/c1-3-5-6-7-9(11)8(10)4-2/h5-7,10H,1,4H2,2H3/b7-6-,10-8+ |
| InChIKey | OUKDQULXJXSFCZ-VAAURPRASA-N |
| XLogP | 1.88 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|