C10H13NO2 — CID 123328689
3-but-2-enylidene-5-iminohexane-2,4-dione (PubChem CID 123328689) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 3-but-2-enylidene-5-iminohexane-2,4-dione.
| Compound Name | 3-but-2-enylidene-5-iminohexane-2,4-dione |
|---|---|
| PubChem CID | 123328689 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 3-but-2-enylidene-5-iminohexane-2,4-dione |
| SMILES | [H]/N=C(\C)C(=O)C(=CC=CC)C(C)=O |
| InChI | InChI=1S/C10H13NO2/c1-4-5-6-9(8(3)12)10(13)7(2)11/h4-6,11H,1-3H3/b5-4?,9-6?,11-7+ |
| InChIKey | ZPAVQQSFVNFPCY-OGKNHGPUSA-N |
| XLogP | 1.69 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|