C8H11NO2 — CID 123872207
3-ethylidene-5-iminohexane-2,4-dione (PubChem CID 123872207) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 3-ethylidene-5-iminohexane-2,4-dione.
| Compound Name | 3-ethylidene-5-iminohexane-2,4-dione |
|---|---|
| PubChem CID | 123872207 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 3-ethylidene-5-iminohexane-2,4-dione |
| SMILES | [H]/N=C(\C)C(=O)C(=CC)C(C)=O |
| InChI | InChI=1S/C8H11NO2/c1-4-7(6(3)10)8(11)5(2)9/h4,9H,1-3H3/b7-4?,9-5+ |
| InChIKey | XIIIXEFRGHGWCJ-YAPARRTASA-N |
| XLogP | 1.13 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|