C8H7NO2 — CID 66973637
2-acetyl-4-iminocyclohexa-2,5-dien-1-one (PubChem CID 66973637) has the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. Its IUPAC name is 2-acetyl-4-iminocyclohexa-2,5-dien-1-one.
| Compound Name | 2-acetyl-4-iminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 66973637 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 2-acetyl-4-iminocyclohexa-2,5-dien-1-one |
| SMILES | [H]/N=C1\C=CC(=O)C(C(C)=O)=C1 |
| InChI | InChI=1S/C8H7NO2/c1-5(10)7-4-6(9)2-3-8(7)11/h2-4,9H,1H3/b9-6+ |
| InChIKey | SCNZYWJGWYVZFY-RMKNXTFCSA-N |
| XLogP | 0.66 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|