C9H13NO2 — CID 123712216
(E)-2-iminonon-7-ene-3,6-dione (PubChem CID 123712216) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is (E)-2-iminonon-7-ene-3,6-dione.
| Compound Name | (E)-2-iminonon-7-ene-3,6-dione |
|---|---|
| PubChem CID | 123712216 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (E)-2-iminonon-7-ene-3,6-dione |
| SMILES | [H]/N=C(\C)C(=O)CCC(=O)/C=C/C |
| InChI | InChI=1S/C9H13NO2/c1-3-4-8(11)5-6-9(12)7(2)10/h3-4,10H,5-6H2,1-2H3/b4-3+,10-7+ |
| InChIKey | UWSWOHDGTCEFHP-YZQQHVNFSA-N |
| XLogP | 1.52 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|