C16H19NO2 — CID 123947533
5-ethyl-6-ethylidene-2-(2-iminopropanoyl)cyclonona-2,4,8-trien-1-one (PubChem CID 123947533) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 5-ethyl-6-ethylidene-2-(2-iminopropanoyl)cyclonona-2,4,8-trien-1-one.
| Compound Name | 5-ethyl-6-ethylidene-2-(2-iminopropanoyl)cyclonona-2,4,8-trien-1-one |
|---|---|
| PubChem CID | 123947533 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 5-ethyl-6-ethylidene-2-(2-iminopropanoyl)cyclonona-2,4,8-trien-1-one |
| SMILES | [H]/N=C(\C)C(=O)C1=CC=C(CC)C(=CC)CC=CC1=O |
| InChI | InChI=1S/C16H19NO2/c1-4-12-7-6-8-15(18)14(16(19)11(3)17)10-9-13(12)5-2/h4,6,8-10,17H,5,7H2,1-3H3/b8-6?,12-4?,13-9?,14-10?,17-11+ |
| InChIKey | QHDBQLJNGDYIMW-HKFFNUMGSA-N |
| XLogP | 3.33 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|