C13H18N2O — CID 123982835
4-(2,6-diiminoheptan-4-ylidene)cyclohex-2-en-1-one (PubChem CID 123982835) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-(2,6-diiminoheptan-4-ylidene)cyclohex-2-en-1-one.
| Compound Name | 4-(2,6-diiminoheptan-4-ylidene)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 123982835 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 4-(2,6-diiminoheptan-4-ylidene)cyclohex-2-en-1-one |
| SMILES | [H]/N=C(\C)CC(C/C(C)=N/[H])=C1C=CC(=O)CC1 |
| InChI | InChI=1S/C13H18N2O/c1-9(14)7-12(8-10(2)15)11-3-5-13(16)6-4-11/h3,5,14-15H,4,6-8H2,1-2H3/b14-9+,15-10+ |
| InChIKey | VVIZUPPSZWFBEK-AOEKMSOUSA-N |
| XLogP | 3.06 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|