C13H16N2O — CID 91473845
2-diazo-3,5-dihydronaphthalen-1-one;propane (PubChem CID 91473845) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-diazo-3,5-dihydronaphthalen-1-one;propane.
| Compound Name | 2-diazo-3,5-dihydronaphthalen-1-one;propane |
|---|---|
| PubChem CID | 91473845 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-diazo-3,5-dihydronaphthalen-1-one;propane |
| SMILES | CCC.[N-]=[N+]=C1CC=C2CC=CC=C2C1=O |
| InChI | InChI=1S/C10H8N2O.C3H8/c11-12-9-6-5-7-3-1-2-4-8(7)10(9)13;1-3-2/h1-2,4-5H,3,6H2;3H2,1-2H3 |
| InChIKey | KUMQWHZDPAEIBP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|