C20H16N6O — CID 57316600
[[4-[[2-[(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)methyl]-6-oxocyclohexen-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]hydrazinylidene]azanide (PubChem CID 57316600) has the molecular formula C20H16N6O and a molecular weight of 356.39 g/mol. Its IUPAC name is [[4-[[2-[(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)methyl]-6-oxocyclohexen-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]hydrazinylidene]azanide.
| Compound Name | [[4-[[2-[(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)methyl]-6-oxocyclohexen-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]hydrazinylidene]azanide |
|---|---|
| PubChem CID | 57316600 |
| Molecular Formula | C20H16N6O |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [[4-[[2-[(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)methyl]-6-oxocyclohexen-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]hydrazinylidene]azanide |
| SMILES | N#[N+]N=C1C=CC(=CC2=C(C=C3C=CC(=NN=[N-])C=C3)C(=O)CCC2)C=C1 |
| InChI | InChI=1S/C20H16N6O/c21-25-23-17-8-4-14(5-9-17)12-16-2-1-3-20(27)19(16)13-15-6-10-18(11-7-15)24-26-22/h4-13H,1-3H2/b14-12-,15-13-,23-17+,24-18+ |
| InChIKey | IYGFUFKIEGALMX-AWAYIESVSA-N |
| XLogP | 4.73 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|