C23H19N6O+ — CID 57298401
3-[3-[2-[3-(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)prop-1-enyl]-5-oxocyclopenten-1-yl]prop-2-enylidene]-6-(iminohydrazinylidene)cyclohexa-1,4-diene (PubChem CID 57298401) has the molecular formula C23H19N6O+ and a molecular weight of 395.45 g/mol. Its IUPAC name is 3-[3-[2-[3-(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)prop-1-enyl]-5-oxocyclopenten-1-yl]prop-2-enylidene]-6-(iminohydrazinylidene)cyclohexa-1,4-diene.
| Compound Name | 3-[3-[2-[3-(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)prop-1-enyl]-5-oxocyclopenten-1-yl]prop-2-enylidene]-6-(iminohydrazinylidene)cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 57298401 |
| Molecular Formula | C23H19N6O+ |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-[3-[2-[3-(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)prop-1-enyl]-5-oxocyclopenten-1-yl]prop-2-enylidene]-6-(iminohydrazinylidene)cyclohexa-1,4-diene |
| SMILES | [H]/N=N/N=C1C=CC(=CC=CC2=C(C=CC=C3C=CC(=N[N+]#N)C=C3)CCC2=O)C=C1 |
| InChI | InChI=1S/C23H19N6O/c24-28-26-20-12-7-17(8-13-20)3-1-5-19-11-16-23(30)22(19)6-2-4-18-9-14-21(15-10-18)27-29-25/h1-10,12-15,25H,11,16H2/q+1/b5-1?,6-2?,17-3-,18-4-,26-20+,27-21+,29-25+ |
| InChIKey | URZHFKPVPKFTIQ-WVXVRIPFSA-N |
| XLogP | 5.46 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|