C23H15N6O+ — CID 170853949
1-[(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)methyl]-3-[[4-(iminohydrazinylidene)cyclohexa-2,5-dien-1-ylidene]methyl]-2-oxoindene (PubChem CID 170853949) has the molecular formula C23H15N6O+ and a molecular weight of 391.41 g/mol. Its IUPAC name is 1-[(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)methyl]-3-[[4-(iminohydrazinylidene)cyclohexa-2,5-dien-1-ylidene]methyl]-2-oxoindene.
| Compound Name | 1-[(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)methyl]-3-[[4-(iminohydrazinylidene)cyclohexa-2,5-dien-1-ylidene]methyl]-2-oxoindene |
|---|---|
| PubChem CID | 170853949 |
| Molecular Formula | C23H15N6O+ |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 1-[(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)methyl]-3-[[4-(iminohydrazinylidene)cyclohexa-2,5-dien-1-ylidene]methyl]-2-oxoindene |
| SMILES | [H]/N=N/N=C1C=CC(=CC2=c3ccccc3=C(C=C3C=CC(=N[N+]#N)C=C3)C2=O)C=C1 |
| InChI | InChI=1S/C23H15N6O/c24-28-26-17-9-5-15(6-10-17)13-21-19-3-1-2-4-20(19)22(23(21)30)14-16-7-11-18(12-8-16)27-29-25/h1-14,24H/q+1/b15-13-,16-14-,26-17+,27-18+,28-24+ |
| InChIKey | AQMNXLFUMJSEDI-PMOOONOXSA-N |
| XLogP | 3.27 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|