C10H6N2O2 — CID 141053386
5-diazo-3H-naphthalene-1,2-dione (PubChem CID 141053386) has the molecular formula C10H6N2O2 and a molecular weight of 186.17 g/mol. Its IUPAC name is 5-diazo-3H-naphthalene-1,2-dione.
| Compound Name | 5-diazo-3H-naphthalene-1,2-dione |
|---|---|
| PubChem CID | 141053386 |
| Molecular Formula | C10H6N2O2 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 5-diazo-3H-naphthalene-1,2-dione |
| SMILES | [N-]=[N+]=C1C=CC=C2C(=O)C(=O)CC=C21 |
| InChI | InChI=1S/C10H6N2O2/c11-12-8-3-1-2-7-6(8)4-5-9(13)10(7)14/h1-4H,5H2 |
| InChIKey | ZDEBFEGCLRYWEI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|