C14H4N4O4 — CID 135082525
4,8-didiazoanthracene-1,5,9,10-tetrone (PubChem CID 135082525) has the molecular formula C14H4N4O4 and a molecular weight of 292.21 g/mol. Its IUPAC name is 4,8-didiazoanthracene-1,5,9,10-tetrone.
| Compound Name | 4,8-didiazoanthracene-1,5,9,10-tetrone |
|---|---|
| PubChem CID | 135082525 |
| Molecular Formula | C14H4N4O4 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 4,8-didiazoanthracene-1,5,9,10-tetrone |
| SMILES | [N-]=[N+]=c1ccc(=O)c2c(=O)c3c(=[N+]=[N-])ccc(=O)c3c(=O)c12 |
| InChI | InChI=1S/C14H4N4O4/c15-17-5-1-3-7(19)11-9(5)13(21)12-8(20)4-2-6(18-16)10(12)14(11)22/h1-4H |
| InChIKey | YOCJPYGUCNLPTQ-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 141.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|