About 5-diazo-6H-naphthalene-1,4-dione
5-diazo-6H-naphthalene-1,4-dione (PubChem CID 23202654) has the molecular formula C10H6N2O2
and a molecular weight of 186.17 g/mol. Its IUPAC name is 5-diazo-6H-naphthalene-1,4-dione.
Molecular Properties
| Compound Name | 5-diazo-6H-naphthalene-1,4-dione |
| PubChem CID | 23202654 |
| Molecular Formula | C10H6N2O2 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 5-diazo-6H-naphthalene-1,4-dione |
| SMILES | [N-]=[N+]=C1CC=CC2=C1C(=O)C=CC2=O |
| InChI | InChI=1S/C10H6N2O2/c11-12-7-3-1-2-6-8(13)4-5-9(14)10(6)7/h1-2,4-5H,3H2 |
| InChIKey | OBNZSYLBIYZWFX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-diazo-6H-naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-diazo-6H-naphthalene-1,4-dione?
The IUPAC name of 5-diazo-6H-naphthalene-1,4-dione (CID 23202654) is 5-diazo-6H-naphthalene-1,4-dione.
What is the SMILES notation for 5-diazo-6H-naphthalene-1,4-dione?
The canonical SMILES for 5-diazo-6H-naphthalene-1,4-dione is [N-]=[N+]=C1CC=CC2=C1C(=O)C=CC2=O.
What is the InChIKey of 5-diazo-6H-naphthalene-1,4-dione?
The InChIKey is OBNZSYLBIYZWFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O2/c11-12-7-3-1-2-6-8(13)4-5-9(14)10(6)7/h1-2,4-5H,3H2.
What are the key properties of 5-diazo-6H-naphthalene-1,4-dione?
5-diazo-6H-naphthalene-1,4-dione has a molecular weight of 186.17 g/mol, XLogP of 0.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-diazo-6H-naphthalene-1,4-dione is sourced from PubChem (CID 23202654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).