About 3,4-diiminoacenaphthylene-1,2-dione
3,4-diiminoacenaphthylene-1,2-dione (PubChem CID 166611148) has the molecular formula C12H6N2O2
and a molecular weight of 210.19 g/mol. Its IUPAC name is 3,4-diiminoacenaphthylene-1,2-dione.
Molecular Properties
| Compound Name | 3,4-diiminoacenaphthylene-1,2-dione |
| PubChem CID | 166611148 |
| Molecular Formula | C12H6N2O2 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 3,4-diiminoacenaphthylene-1,2-dione |
| SMILES | [H]/N=C1/C2=c3c(cccc3=C/C1=N\[H])C(=O)C2=O |
| InChI | InChI=1S/C12H6N2O2/c13-7-4-5-2-1-3-6-8(5)9(10(7)14)12(16)11(6)15/h1-4,13-14H/b13-7+,14-10+ |
| InChIKey | AJWBINJUCOFFLK-SEWRKBRGSA-N |
| XLogP | -0.56 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diiminoacenaphthylene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diiminoacenaphthylene-1,2-dione?
The IUPAC name of 3,4-diiminoacenaphthylene-1,2-dione (CID 166611148) is 3,4-diiminoacenaphthylene-1,2-dione.
What is the SMILES notation for 3,4-diiminoacenaphthylene-1,2-dione?
The canonical SMILES for 3,4-diiminoacenaphthylene-1,2-dione is [H]/N=C1/C2=c3c(cccc3=C/C1=N\[H])C(=O)C2=O.
What is the InChIKey of 3,4-diiminoacenaphthylene-1,2-dione?
The InChIKey is AJWBINJUCOFFLK-SEWRKBRGSA-N. The full InChI is InChI=1S/C12H6N2O2/c13-7-4-5-2-1-3-6-8(5)9(10(7)14)12(16)11(6)15/h1-4,13-14H/b13-7+,14-10+.
What are the key properties of 3,4-diiminoacenaphthylene-1,2-dione?
3,4-diiminoacenaphthylene-1,2-dione has a molecular weight of 210.19 g/mol, XLogP of -0.56, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diiminoacenaphthylene-1,2-dione is sourced from PubChem (CID 166611148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).