C9H9NO — CID 141322519
2-imino-4,5-dihydro-3H-inden-1-one (PubChem CID 141322519) has the molecular formula C9H9NO and a molecular weight of 147.18 g/mol. Its IUPAC name is 2-imino-4,5-dihydro-3H-inden-1-one.
| Compound Name | 2-imino-4,5-dihydro-3H-inden-1-one |
|---|---|
| PubChem CID | 141322519 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 2-imino-4,5-dihydro-3H-inden-1-one |
| SMILES | [H]/N=C1\CC2=C(C=CCC2)C1=O |
| InChI | InChI=1S/C9H9NO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h2,4,10H,1,3,5H2/b10-8+ |
| InChIKey | BKZJDSVEADCORJ-CSKARUKUSA-N |
| XLogP | 1.63 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|