C10H6N6O2 — CID 19038783
[(3-diazonioimino-1,8-dioxo-7,8a-dihydronaphthalen-2-ylidene)hydrazinylidene]azanide (PubChem CID 19038783) has the molecular formula C10H6N6O2 and a molecular weight of 242.20 g/mol. Its IUPAC name is [(3-diazonioimino-1,8-dioxo-7,8a-dihydronaphthalen-2-ylidene)hydrazinylidene]azanide.
| Compound Name | [(3-diazonioimino-1,8-dioxo-7,8a-dihydronaphthalen-2-ylidene)hydrazinylidene]azanide |
|---|---|
| PubChem CID | 19038783 |
| Molecular Formula | C10H6N6O2 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | [(3-diazonioimino-1,8-dioxo-7,8a-dihydronaphthalen-2-ylidene)hydrazinylidene]azanide |
| SMILES | N#[N+]N=C1C=C2C=CCC(=O)C2C(=O)C1=NN=[N-] |
| InChI | InChI=1S/C10H6N6O2/c11-15-13-6-4-5-2-1-3-7(17)8(5)10(18)9(6)14-16-12/h1-2,4,8H,3H2 |
| InChIKey | PBGDQUFOECWCLN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 121.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|