C10H7N6O2+ — CID 57192611
6-diazonioimino-7-(iminohydrazinylidene)-1,8-dioxo-2,8a-dihydronaphthalene (PubChem CID 57192611) has the molecular formula C10H7N6O2+ and a molecular weight of 243.21 g/mol. Its IUPAC name is 6-diazonioimino-7-(iminohydrazinylidene)-1,8-dioxo-2,8a-dihydronaphthalene.
| Compound Name | 6-diazonioimino-7-(iminohydrazinylidene)-1,8-dioxo-2,8a-dihydronaphthalene |
|---|---|
| PubChem CID | 57192611 |
| Molecular Formula | C10H7N6O2+ |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 6-diazonioimino-7-(iminohydrazinylidene)-1,8-dioxo-2,8a-dihydronaphthalene |
| SMILES | [H]/N=N/N=C1C(=O)C2C(=O)CC=CC2=CC1=N[N+]#N |
| InChI | InChI=1S/C10H7N6O2/c11-15-13-6-4-5-2-1-3-7(17)8(5)10(18)9(6)14-16-12/h1-2,4,8,12H,3H2/q+1/b13-6?,14-9?,16-12+ |
| InChIKey | AMJQJQSTZFBIIE-QVSNLDFBSA-N |
| XLogP | 1.24 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|