C10H14N2O — CID 156776019
4-hydrazinylidene-6,7,8,8a-tetrahydro-1H-naphthalen-2-one (PubChem CID 156776019) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-hydrazinylidene-6,7,8,8a-tetrahydro-1H-naphthalen-2-one.
| Compound Name | 4-hydrazinylidene-6,7,8,8a-tetrahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 156776019 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 4-hydrazinylidene-6,7,8,8a-tetrahydro-1H-naphthalen-2-one |
| SMILES | NN=C1CC(=O)CC2CCCC=C12 |
| InChI | InChI=1S/C10H14N2O/c11-12-10-6-8(13)5-7-3-1-2-4-9(7)10/h4,7H,1-3,5-6,11H2 |
| InChIKey | CNPPEEKCLRPEDQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|