C10H12N2O — CID 59968537
2-diazo-3,5,6,7,8,8a-hexahydronaphthalen-1-one (PubChem CID 59968537) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-diazo-3,5,6,7,8,8a-hexahydronaphthalen-1-one.
| Compound Name | 2-diazo-3,5,6,7,8,8a-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 59968537 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-diazo-3,5,6,7,8,8a-hexahydronaphthalen-1-one |
| SMILES | [N-]=[N+]=C1CC=C2CCCCC2C1=O |
| InChI | InChI=1S/C10H12N2O/c11-12-9-6-5-7-3-1-2-4-8(7)10(9)13/h5,8H,1-4,6H2 |
| InChIKey | XUTQGKSBPMTSMT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|