C11H14N2O — CID 131871093
(4aR)-3-diazo-4a-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 131871093) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is (4aR)-3-diazo-4a-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (4aR)-3-diazo-4a-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 131871093 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (4aR)-3-diazo-4a-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | C[C@]12CCCCC1=CC(=O)C(=[N+]=[N-])C2 |
| InChI | InChI=1S/C11H14N2O/c1-11-5-3-2-4-8(11)6-10(14)9(7-11)13-12/h6H,2-5,7H2,1H3/t11-/m1/s1 |
| InChIKey | SCFOGTYUXACYCL-LLVKDONJSA-N |
| XLogP | 2.14 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|