C11H10N2O — CID 134986621
4-diazo-3-methyl-4a,8a-dihydronaphthalen-1-one (PubChem CID 134986621) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 4-diazo-3-methyl-4a,8a-dihydronaphthalen-1-one.
| Compound Name | 4-diazo-3-methyl-4a,8a-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 134986621 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 4-diazo-3-methyl-4a,8a-dihydronaphthalen-1-one |
| SMILES | CC1=CC(=O)C2C=CC=CC2C1=[N+]=[N-] |
| InChI | InChI=1S/C11H10N2O/c1-7-6-10(14)8-4-2-3-5-9(8)11(7)13-12/h2-6,8-9H,1H3 |
| InChIKey | UOEYNJLEUSSEOM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|