About 1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one
1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one (PubChem CID 175712731) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one |
| PubChem CID | 175712731 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one |
| SMILES | CCC(=O)C1C=CC=CC1=[N+]=[N-] |
| InChI | InChI=1S/C9H10N2O/c1-2-9(12)7-5-3-4-6-8(7)11-10/h3-7H,2H2,1H3 |
| InChIKey | SBQYMMPVLVSIDH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one?
The IUPAC name of 1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one (CID 175712731) is 1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one.
What is the SMILES notation for 1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one?
The canonical SMILES for 1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one is CCC(=O)C1C=CC=CC1=[N+]=[N-].
What is the InChIKey of 1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one?
The InChIKey is SBQYMMPVLVSIDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-2-9(12)7-5-3-4-6-8(7)11-10/h3-7H,2H2,1H3.
What are the key properties of 1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one?
1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one has a molecular weight of 162.19 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-diazocyclohexa-2,4-dien-1-yl)propan-1-one is sourced from PubChem (CID 175712731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).