C22H20N6O — CID 123219752
[[4-[[2-[(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)methyl]-3-ethyl-6-oxocyclohexen-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]hydrazinylidene]azanide (PubChem CID 123219752) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is [[4-[[2-[(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)methyl]-3-ethyl-6-oxocyclohexen-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]hydrazinylidene]azanide.
| Compound Name | [[4-[[2-[(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)methyl]-3-ethyl-6-oxocyclohexen-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]hydrazinylidene]azanide |
|---|---|
| PubChem CID | 123219752 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | [[4-[[2-[(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)methyl]-3-ethyl-6-oxocyclohexen-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]hydrazinylidene]azanide |
| SMILES | CCC1CCC(=O)C(C=C2C=CC(=NN=[N-])C=C2)=C1C=C1C=CC(=N[N+]#N)C=C1 |
| InChI | InChI=1S/C22H20N6O/c1-2-17-7-12-22(29)21(14-16-5-10-19(11-6-16)26-28-24)20(17)13-15-3-8-18(9-4-15)25-27-23/h3-6,8-11,13-14,17H,2,7,12H2,1H3/b15-13-,16-14-,25-18+,26-19+ |
| InChIKey | MPMAWKWPYYBFLB-IXJBQJIXSA-N |
| XLogP | 5.36 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|