C11H8N2O — CID 134924844
(4Z,6Z,8Z)-2-diazo-1H-cyclopenta[8]annulen-3-one (PubChem CID 134924844) has the molecular formula C11H8N2O and a molecular weight of 184.20 g/mol. Its IUPAC name is (4Z,6Z,8Z)-2-diazo-1H-cyclopenta[8]annulen-3-one.
| Compound Name | (4Z,6Z,8Z)-2-diazo-1H-cyclopenta[8]annulen-3-one |
|---|---|
| PubChem CID | 134924844 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | (4Z,6Z,8Z)-2-diazo-1H-cyclopenta[8]annulen-3-one |
| SMILES | [N-]=[N+]=C1CC2=C(/C=C\C=C/C=C\2)C1=O |
| InChI | InChI=1S/C11H8N2O/c12-13-10-7-8-5-3-1-2-4-6-9(8)11(10)14/h1-6H,7H2/b2-1-,3-1-,4-2-,5-3-,6-4-,8-5-,9-6+ |
| InChIKey | CRVXJSGXNIZBNX-AOAZNCMSSA-N |
| XLogP | 1.61 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|