C11H9NO2 — CID 134877412
(2Z,4Z,6Z,8Z)-2-hydroxyimino-1H-cyclopenta[8]annulen-3-one (PubChem CID 134877412) has the molecular formula C11H9NO2 and a molecular weight of 187.20 g/mol. Its IUPAC name is (2Z,4Z,6Z,8Z)-2-hydroxyimino-1H-cyclopenta[8]annulen-3-one.
| Compound Name | (2Z,4Z,6Z,8Z)-2-hydroxyimino-1H-cyclopenta[8]annulen-3-one |
|---|---|
| PubChem CID | 134877412 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | (2Z,4Z,6Z,8Z)-2-hydroxyimino-1H-cyclopenta[8]annulen-3-one |
| SMILES | O=C1C2=C(/C=C\C=C/C=C\2)C/C1=N/O |
| InChI | InChI=1S/C11H9NO2/c13-11-9-6-4-2-1-3-5-8(9)7-10(11)12-14/h1-6,14H,7H2/b2-1-,3-1-,4-2-,5-3-,6-4-,8-5-,9-6+,12-10- |
| InChIKey | SIDVTEGRBDMHCR-NAHFMEDGSA-N |
| XLogP | 1.77 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|