C11H15NO2 — CID 88876154
1-(6-ethoxyiminocyclohexa-1,3-dien-1-yl)propan-1-one (PubChem CID 88876154) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-(6-ethoxyiminocyclohexa-1,3-dien-1-yl)propan-1-one.
| Compound Name | 1-(6-ethoxyiminocyclohexa-1,3-dien-1-yl)propan-1-one |
|---|---|
| PubChem CID | 88876154 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1-(6-ethoxyiminocyclohexa-1,3-dien-1-yl)propan-1-one |
| SMILES | CCON=C1CC=CC=C1C(=O)CC |
| InChI | InChI=1S/C11H15NO2/c1-3-11(13)9-7-5-6-8-10(9)12-14-4-2/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | VTSYGXUEDNHTGP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|