C11H16N2O — CID 137128758
(7E,9E)-2-diazoundeca-7,9-dien-3-one (PubChem CID 137128758) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (7E,9E)-2-diazoundeca-7,9-dien-3-one.
| Compound Name | (7E,9E)-2-diazoundeca-7,9-dien-3-one |
|---|---|
| PubChem CID | 137128758 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (7E,9E)-2-diazoundeca-7,9-dien-3-one |
| SMILES | C/C=C/C=C/CCCC(=O)C(C)=[N+]=[N-] |
| InChI | InChI=1S/C11H16N2O/c1-3-4-5-6-7-8-9-11(14)10(2)13-12/h3-6H,7-9H2,1-2H3/b4-3+,6-5+ |
| InChIKey | GTHGWWLXCOHSTM-VNKDHWASSA-N |
| XLogP | 2.55 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|