About 1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide
1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide (PubChem CID 141357153) has the molecular formula C8H9BrN2O
and a molecular weight of 229.08 g/mol. Its IUPAC name is 1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide.
Molecular Properties
| Compound Name | 1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide |
| PubChem CID | 141357153 |
| Molecular Formula | C8H9BrN2O |
| Molecular Weight | 229.08 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide |
| SMILES | Br.CC(=O)C1=CC=CC(=[N+]=[N-])C1 |
| InChI | InChI=1S/C8H8N2O.BrH/c1-6(11)7-3-2-4-8(5-7)10-9;/h2-4H,5H2,1H3;1H |
| InChIKey | GPCQEKFHQSVJRQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.08 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide?
The IUPAC name of 1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide (CID 141357153) is 1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide.
What is the SMILES notation for 1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide?
The canonical SMILES for 1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide is Br.CC(=O)C1=CC=CC(=[N+]=[N-])C1.
What is the InChIKey of 1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide?
The InChIKey is GPCQEKFHQSVJRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O.BrH/c1-6(11)7-3-2-4-8(5-7)10-9;/h2-4H,5H2,1H3;1H.
What are the key properties of 1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide?
1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide has a molecular weight of 229.08 g/mol, XLogP of 1.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-diazocyclohexa-1,3-dien-1-yl)ethanone;hydrobromide is sourced from PubChem (CID 141357153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).