C10H12NO+ — CID 123555746
1-(4-imino-2,6-dimethylcyclohexa-1,5-dien-1-yl)ethanone (PubChem CID 123555746) has the molecular formula C10H12NO+ and a molecular weight of 162.21 g/mol. Its IUPAC name is 1-(4-imino-2,6-dimethylcyclohexa-1,5-dien-1-yl)ethanone.
| Compound Name | 1-(4-imino-2,6-dimethylcyclohexa-1,5-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 123555746 |
| Molecular Formula | C10H12NO+ |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1-(4-imino-2,6-dimethylcyclohexa-1,5-dien-1-yl)ethanone |
| SMILES | [H]/N=C1\C=C(C)C(C(C)=O)=C(C)[CH+]1 |
| InChI | InChI=1S/C10H12NO/c1-6-4-9(11)5-7(2)10(6)8(3)12/h4-5,11H,1-3H3/q+1 |
| InChIKey | RGOJAFFJJCMUQR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|