C6H4N2O2 — CID 123944705
5,6-diiminocyclohex-3-ene-1,2-dione (PubChem CID 123944705) has the molecular formula C6H4N2O2 and a molecular weight of 136.11 g/mol. Its IUPAC name is 5,6-diiminocyclohex-3-ene-1,2-dione.
| Compound Name | 5,6-diiminocyclohex-3-ene-1,2-dione |
|---|---|
| PubChem CID | 123944705 |
| Molecular Formula | C6H4N2O2 |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | 5,6-diiminocyclohex-3-ene-1,2-dione |
| SMILES | [H]/N=c1\ccc(=O)c(=O)\c1=N\[H] |
| InChI | InChI=1S/C6H4N2O2/c7-3-1-2-4(9)6(10)5(3)8/h1-2,7-8H/b7-3+,8-5+ |
| InChIKey | DURFMSJXXUFTKM-IUMFQGNOSA-N |
| XLogP | -1.76 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|