C6H4N2O4 — CID 135485325
2,6-bis(hydroxyimino)cyclohex-4-ene-1,3-dione (PubChem CID 135485325) has the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. Its IUPAC name is 2,6-bis(hydroxyimino)cyclohex-4-ene-1,3-dione.
| Compound Name | 2,6-bis(hydroxyimino)cyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 135485325 |
| Molecular Formula | C6H4N2O4 |
| Molecular Weight | 168.11 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 2,6-bis(hydroxyimino)cyclohex-4-ene-1,3-dione |
| SMILES | O=c1ccc(=NO)c(=O)c1=NO |
| InChI | InChI=1S/C6H4N2O4/c9-4-2-1-3(7-11)6(10)5(4)8-12/h1-2,11-12H |
| InChIKey | GRFONTIAJGGAHL-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.11 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|