About 2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol
2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol (PubChem CID 134860299) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is 2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol.
Molecular Properties
| Compound Name | 2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol |
| PubChem CID | 134860299 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol |
| SMILES | CCC1(OC)C=CC(OC)(C(C)(O)CC)O1 |
| InChI | InChI=1S/C12H22O4/c1-6-10(3,13)12(15-5)9-8-11(7-2,14-4)16-12/h8-9,13H,6-7H2,1-5H3 |
| InChIKey | OIMDGPRAMRODDS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol?
The IUPAC name of 2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol (CID 134860299) is 2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol.
What is the SMILES notation for 2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol?
The canonical SMILES for 2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol is CCC1(OC)C=CC(OC)(C(C)(O)CC)O1.
What is the InChIKey of 2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol?
The InChIKey is OIMDGPRAMRODDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4/c1-6-10(3,13)12(15-5)9-8-11(7-2,14-4)16-12/h8-9,13H,6-7H2,1-5H3.
What are the key properties of 2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol?
2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol has a molecular weight of 230.30 g/mol, XLogP of 1.83, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethyl-2,5-dimethoxyfuran-2-yl)butan-2-ol is sourced from PubChem (CID 134860299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).